C23H24F3NO — CID 15893145
4-[(2E,4E)-1,1,1-trifluoro-5-phenyl-3-(2-phenylethyl)penta-2,4-dien-2-yl]morpholine (PubChem CID 15893145) has the molecular formula C23H24F3NO and a molecular weight of 387.44 g/mol. Its IUPAC name is 4-[(2E,4E)-1,1,1-trifluoro-5-phenyl-3-(2-phenylethyl)penta-2,4-dien-2-yl]morpholine.
| Compound Name | 4-[(2E,4E)-1,1,1-trifluoro-5-phenyl-3-(2-phenylethyl)penta-2,4-dien-2-yl]morpholine |
|---|---|
| PubChem CID | 15893145 |
| Molecular Formula | C23H24F3NO |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 4-[(2E,4E)-1,1,1-trifluoro-5-phenyl-3-(2-phenylethyl)penta-2,4-dien-2-yl]morpholine |
| SMILES | FC(F)(F)/C(=C(\C=C\c1ccccc1)CCc1ccccc1)N1CCOCC1 |
| InChI | InChI=1S/C23H24F3NO/c24-23(25,26)22(27-15-17-28-18-16-27)21(13-11-19-7-3-1-4-8-19)14-12-20-9-5-2-6-10-20/h1-11,13H,12,14-18H2/b13-11+,22-21- |
| InChIKey | YDZWOMFKALMYPF-UAWDQJTNSA-N |
| XLogP | 5.48 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|