C16H18F2N2O4 — CID 162580815
(E)-4,4-difluoro-2-(morpholine-4-carbonylamino)-5-phenylpent-2-enoic acid (PubChem CID 162580815) has the molecular formula C16H18F2N2O4 and a molecular weight of 340.33 g/mol. Its IUPAC name is (E)-4,4-difluoro-2-(morpholine-4-carbonylamino)-5-phenylpent-2-enoic acid.
| Compound Name | (E)-4,4-difluoro-2-(morpholine-4-carbonylamino)-5-phenylpent-2-enoic acid |
|---|---|
| PubChem CID | 162580815 |
| Molecular Formula | C16H18F2N2O4 |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | (E)-4,4-difluoro-2-(morpholine-4-carbonylamino)-5-phenylpent-2-enoic acid |
| SMILES | O=C(O)/C(=C\C(F)(F)Cc1ccccc1)NC(=O)N1CCOCC1 |
| InChI | InChI=1S/C16H18F2N2O4/c17-16(18,10-12-4-2-1-3-5-12)11-13(14(21)22)19-15(23)20-6-8-24-9-7-20/h1-5,11H,6-10H2,(H,19,23)(H,21,22)/b13-11+ |
| InChIKey | ZKKVRXPPELICMD-ACCUITESSA-N |
| XLogP | 1.87 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|