C15H20N2O6S — CID 69425574
2-(morpholine-4-carbonylamino)-4-phenyl-3-sulfinobutanoic acid (PubChem CID 69425574) has the molecular formula C15H20N2O6S and a molecular weight of 356.40 g/mol. Its IUPAC name is 2-(morpholine-4-carbonylamino)-4-phenyl-3-sulfinobutanoic acid.
| Compound Name | 2-(morpholine-4-carbonylamino)-4-phenyl-3-sulfinobutanoic acid |
|---|---|
| PubChem CID | 69425574 |
| Molecular Formula | C15H20N2O6S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | 2-(morpholine-4-carbonylamino)-4-phenyl-3-sulfinobutanoic acid |
| SMILES | O=C(O)C(NC(=O)N1CCOCC1)C(Cc1ccccc1)S(=O)O |
| InChI | InChI=1S/C15H20N2O6S/c18-14(19)13(16-15(20)17-6-8-23-9-7-17)12(24(21)22)10-11-4-2-1-3-5-11/h1-5,12-13H,6-10H2,(H,16,20)(H,18,19)(H,21,22) |
| InChIKey | VPCGEFSQPWDNIT-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|