C13H15Cl3N2O3 — CID 2831270
N-(2,2,2-trichloro-1-phenoxyethyl)morpholine-4-carboxamide (PubChem CID 2831270) has the molecular formula C13H15Cl3N2O3 and a molecular weight of 353.63 g/mol. Its IUPAC name is N-(2,2,2-trichloro-1-phenoxyethyl)morpholine-4-carboxamide.
| Compound Name | N-(2,2,2-trichloro-1-phenoxyethyl)morpholine-4-carboxamide |
|---|---|
| PubChem CID | 2831270 |
| Molecular Formula | C13H15Cl3N2O3 |
| Molecular Weight | 353.63 g/mol |
| Exact Mass | 352.01 |
| IUPAC Name | N-(2,2,2-trichloro-1-phenoxyethyl)morpholine-4-carboxamide |
| SMILES | O=C(NC(Oc1ccccc1)C(Cl)(Cl)Cl)N1CCOCC1 |
| InChI | InChI=1S/C13H15Cl3N2O3/c14-13(15,16)11(21-10-4-2-1-3-5-10)17-12(19)18-6-8-20-9-7-18/h1-5,11H,6-9H2,(H,17,19) |
| InChIKey | MLVXVILMXBZRMZ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.63 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|