C12H19Cl3N4O3S — CID 35580254
N-[(1R)-2,2,2-trichloro-1-(morpholine-4-carbothioylamino)ethyl]morpholine-4-carboxamide (PubChem CID 35580254) has the molecular formula C12H19Cl3N4O3S and a molecular weight of 405.74 g/mol. Its IUPAC name is N-[(1R)-2,2,2-trichloro-1-(morpholine-4-carbothioylamino)ethyl]morpholine-4-carboxamide.
| Compound Name | N-[(1R)-2,2,2-trichloro-1-(morpholine-4-carbothioylamino)ethyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 35580254 |
| Molecular Formula | C12H19Cl3N4O3S |
| Molecular Weight | 405.74 g/mol |
| Exact Mass | 404.02 |
| IUPAC Name | N-[(1R)-2,2,2-trichloro-1-(morpholine-4-carbothioylamino)ethyl]morpholine-4-carboxamide |
| SMILES | O=C(N[C@H](NC(=S)N1CCOCC1)C(Cl)(Cl)Cl)N1CCOCC1 |
| InChI | InChI=1S/C12H19Cl3N4O3S/c13-12(14,15)9(16-10(20)18-1-5-21-6-2-18)17-11(23)19-3-7-22-8-4-19/h9H,1-8H2,(H,16,20)(H,17,23)/t9-/m1/s1 |
| InChIKey | CWVMDGOPILZNSU-SECBINFHSA-N |
| XLogP | 0.93 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.74 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|