C15H18Cl3N5O5S — CID 45155592
N-[2,2,2-trichloro-1-[(2-methoxy-5-nitrophenyl)carbamothioylamino]ethyl]morpholine-4-carboxamide (PubChem CID 45155592) has the molecular formula C15H18Cl3N5O5S and a molecular weight of 486.77 g/mol. Its IUPAC name is N-[2,2,2-trichloro-1-[(2-methoxy-5-nitrophenyl)carbamothioylamino]ethyl]morpholine-4-carboxamide.
| Compound Name | N-[2,2,2-trichloro-1-[(2-methoxy-5-nitrophenyl)carbamothioylamino]ethyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 45155592 |
| Molecular Formula | C15H18Cl3N5O5S |
| Molecular Weight | 486.77 g/mol |
| Exact Mass | 485.01 |
| IUPAC Name | N-[2,2,2-trichloro-1-[(2-methoxy-5-nitrophenyl)carbamothioylamino]ethyl]morpholine-4-carboxamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=S)NC(NC(=O)N1CCOCC1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C15H18Cl3N5O5S/c1-27-11-3-2-9(23(25)26)8-10(11)19-13(29)20-12(15(16,17)18)21-14(24)22-4-6-28-7-5-22/h2-3,8,12H,4-7H2,1H3,(H,21,24)(H2,19,20,29) |
| InChIKey | NRZUNRTYNSRCTD-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 118.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.77 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|