C24H24N4O4S — CID 10027451
(2R)-N-(3,4-dimethylphenyl)-2-[(2-methoxy-5-nitrophenyl)carbamothioylamino]-2-phenylacetamide (PubChem CID 10027451) has the molecular formula C24H24N4O4S and a molecular weight of 464.55 g/mol. Its IUPAC name is (2R)-N-(3,4-dimethylphenyl)-2-[(2-methoxy-5-nitrophenyl)carbamothioylamino]-2-phenylacetamide.
| Compound Name | (2R)-N-(3,4-dimethylphenyl)-2-[(2-methoxy-5-nitrophenyl)carbamothioylamino]-2-phenylacetamide |
|---|---|
| PubChem CID | 10027451 |
| Molecular Formula | C24H24N4O4S |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | (2R)-N-(3,4-dimethylphenyl)-2-[(2-methoxy-5-nitrophenyl)carbamothioylamino]-2-phenylacetamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=S)N[C@@H](C(=O)Nc1ccc(C)c(C)c1)c1ccccc1 |
| InChI | InChI=1S/C24H24N4O4S/c1-15-9-10-18(13-16(15)2)25-23(29)22(17-7-5-4-6-8-17)27-24(33)26-20-14-19(28(30)31)11-12-21(20)32-3/h4-14,22H,1-3H3,(H,25,29)(H2,26,27,33)/t22-/m1/s1 |
| InChIKey | KZFFAMIHDQSRCD-JOCHJYFZSA-N |
| XLogP | 4.89 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|