C17H14Cl4N4O4S — CID 3628411
2-chloro-N-[2,2,2-trichloro-1-[(2-methoxy-5-nitrophenyl)carbamothioylamino]ethyl]benzamide (PubChem CID 3628411) has the molecular formula C17H14Cl4N4O4S and a molecular weight of 512.20 g/mol. Its IUPAC name is 2-chloro-N-[2,2,2-trichloro-1-[(2-methoxy-5-nitrophenyl)carbamothioylamino]ethyl]benzamide.
| Compound Name | 2-chloro-N-[2,2,2-trichloro-1-[(2-methoxy-5-nitrophenyl)carbamothioylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 3628411 |
| Molecular Formula | C17H14Cl4N4O4S |
| Molecular Weight | 512.20 g/mol |
| Exact Mass | 509.95 |
| IUPAC Name | 2-chloro-N-[2,2,2-trichloro-1-[(2-methoxy-5-nitrophenyl)carbamothioylamino]ethyl]benzamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=S)NC(NC(=O)c1ccccc1Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C17H14Cl4N4O4S/c1-29-13-7-6-9(25(27)28)8-12(13)22-16(30)24-15(17(19,20)21)23-14(26)10-4-2-3-5-11(10)18/h2-8,15H,1H3,(H,23,26)(H2,22,24,30) |
| InChIKey | IQRQGBQEOQLZDS-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.20 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|