C19H27Cl3N4O4S — CID 3093600
N-[2,2,2-trichloro-1-[(2-methoxy-5-nitrophenyl)carbamothioylamino]ethyl]nonanamide (PubChem CID 3093600) has the molecular formula C19H27Cl3N4O4S and a molecular weight of 513.88 g/mol. Its IUPAC name is N-[2,2,2-trichloro-1-[(2-methoxy-5-nitrophenyl)carbamothioylamino]ethyl]nonanamide.
| Compound Name | N-[2,2,2-trichloro-1-[(2-methoxy-5-nitrophenyl)carbamothioylamino]ethyl]nonanamide |
|---|---|
| PubChem CID | 3093600 |
| Molecular Formula | C19H27Cl3N4O4S |
| Molecular Weight | 513.88 g/mol |
| Exact Mass | 512.08 |
| IUPAC Name | N-[2,2,2-trichloro-1-[(2-methoxy-5-nitrophenyl)carbamothioylamino]ethyl]nonanamide |
| SMILES | CCCCCCCCC(=O)NC(NC(=S)Nc1cc([N+](=O)[O-])ccc1OC)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C19H27Cl3N4O4S/c1-3-4-5-6-7-8-9-16(27)24-17(19(20,21)22)25-18(31)23-14-12-13(26(28)29)10-11-15(14)30-2/h10-12,17H,3-9H2,1-2H3,(H,24,27)(H2,23,25,31) |
| InChIKey | KNFRJBBZJNUSKR-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.88 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|