C15H20Cl3N3O3 — CID 3092412
N-[2,2,2-trichloro-1-(4-nitroanilino)ethyl]heptanamide (PubChem CID 3092412) has the molecular formula C15H20Cl3N3O3 and a molecular weight of 396.70 g/mol. Its IUPAC name is N-[2,2,2-trichloro-1-(4-nitroanilino)ethyl]heptanamide.
| Compound Name | N-[2,2,2-trichloro-1-(4-nitroanilino)ethyl]heptanamide |
|---|---|
| PubChem CID | 3092412 |
| Molecular Formula | C15H20Cl3N3O3 |
| Molecular Weight | 396.70 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | N-[2,2,2-trichloro-1-(4-nitroanilino)ethyl]heptanamide |
| SMILES | CCCCCCC(=O)NC(Nc1ccc([N+](=O)[O-])cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C15H20Cl3N3O3/c1-2-3-4-5-6-13(22)20-14(15(16,17)18)19-11-7-9-12(10-8-11)21(23)24/h7-10,14,19H,2-6H2,1H3,(H,20,22) |
| InChIKey | FRGXFVPWGRPRNC-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.70 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|