C11H13Cl3N4O3 — CID 7064886
1,1-dimethyl-3-[(1S)-2,2,2-trichloro-1-(4-nitroanilino)ethyl]urea (PubChem CID 7064886) has the molecular formula C11H13Cl3N4O3 and a molecular weight of 355.61 g/mol. Its IUPAC name is 1,1-dimethyl-3-[(1S)-2,2,2-trichloro-1-(4-nitroanilino)ethyl]urea.
| Compound Name | 1,1-dimethyl-3-[(1S)-2,2,2-trichloro-1-(4-nitroanilino)ethyl]urea |
|---|---|
| PubChem CID | 7064886 |
| Molecular Formula | C11H13Cl3N4O3 |
| Molecular Weight | 355.61 g/mol |
| Exact Mass | 354.01 |
| IUPAC Name | 1,1-dimethyl-3-[(1S)-2,2,2-trichloro-1-(4-nitroanilino)ethyl]urea |
| SMILES | CN(C)C(=O)N[C@H](Nc1ccc([N+](=O)[O-])cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H13Cl3N4O3/c1-17(2)10(19)16-9(11(12,13)14)15-7-3-5-8(6-4-7)18(20)21/h3-6,9,15H,1-2H3,(H,16,19)/t9-/m0/s1 |
| InChIKey | VMRBNSWQWIQWFL-VIFPVBQESA-N |
| XLogP | 2.97 |
| TPSA | 87.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.61 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|