C12H15Cl3N4O3 — CID 46494814
1,1-dimethyl-3-[2,2,2-trichloro-1-(2-methyl-4-nitroanilino)ethyl]urea (PubChem CID 46494814) has the molecular formula C12H15Cl3N4O3 and a molecular weight of 369.64 g/mol. Its IUPAC name is 1,1-dimethyl-3-[2,2,2-trichloro-1-(2-methyl-4-nitroanilino)ethyl]urea.
| Compound Name | 1,1-dimethyl-3-[2,2,2-trichloro-1-(2-methyl-4-nitroanilino)ethyl]urea |
|---|---|
| PubChem CID | 46494814 |
| Molecular Formula | C12H15Cl3N4O3 |
| Molecular Weight | 369.64 g/mol |
| Exact Mass | 368.02 |
| IUPAC Name | 1,1-dimethyl-3-[2,2,2-trichloro-1-(2-methyl-4-nitroanilino)ethyl]urea |
| SMILES | Cc1cc([N+](=O)[O-])ccc1NC(NC(=O)N(C)C)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H15Cl3N4O3/c1-7-6-8(19(21)22)4-5-9(7)16-10(12(13,14)15)17-11(20)18(2)3/h4-6,10,16H,1-3H3,(H,17,20) |
| InChIKey | MSVVQCCNJOWJFE-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 87.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.64 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|