C12H13BrCl3N3O3 — CID 34316646
N-[(1S)-1-(2-bromo-4-nitroanilino)-2,2,2-trichloroethyl]-2-methylpropanamide (PubChem CID 34316646) has the molecular formula C12H13BrCl3N3O3 and a molecular weight of 433.52 g/mol. Its IUPAC name is N-[(1S)-1-(2-bromo-4-nitroanilino)-2,2,2-trichloroethyl]-2-methylpropanamide.
| Compound Name | N-[(1S)-1-(2-bromo-4-nitroanilino)-2,2,2-trichloroethyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 34316646 |
| Molecular Formula | C12H13BrCl3N3O3 |
| Molecular Weight | 433.52 g/mol |
| Exact Mass | 430.92 |
| IUPAC Name | N-[(1S)-1-(2-bromo-4-nitroanilino)-2,2,2-trichloroethyl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)N[C@H](Nc1ccc([N+](=O)[O-])cc1Br)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H13BrCl3N3O3/c1-6(2)10(20)18-11(12(14,15)16)17-9-4-3-7(19(21)22)5-8(9)13/h3-6,11,17H,1-2H3,(H,18,20)/t11-/m0/s1 |
| InChIKey | NRWVWVKYXZMXMY-NSHDSACASA-N |
| XLogP | 4.24 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.52 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|