C12H13Cl3N2O4 — CID 2831391
2-methyl-N-[2,2,2-trichloro-1-(4-nitrophenoxy)ethyl]propanamide (PubChem CID 2831391) has the molecular formula C12H13Cl3N2O4 and a molecular weight of 355.61 g/mol. Its IUPAC name is 2-methyl-N-[2,2,2-trichloro-1-(4-nitrophenoxy)ethyl]propanamide.
| Compound Name | 2-methyl-N-[2,2,2-trichloro-1-(4-nitrophenoxy)ethyl]propanamide |
|---|---|
| PubChem CID | 2831391 |
| Molecular Formula | C12H13Cl3N2O4 |
| Molecular Weight | 355.61 g/mol |
| Exact Mass | 353.99 |
| IUPAC Name | 2-methyl-N-[2,2,2-trichloro-1-(4-nitrophenoxy)ethyl]propanamide |
| SMILES | CC(C)C(=O)NC(Oc1ccc([N+](=O)[O-])cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H13Cl3N2O4/c1-7(2)10(18)16-11(12(13,14)15)21-9-5-3-8(4-6-9)17(19)20/h3-7,11H,1-2H3,(H,16,18) |
| InChIKey | HAAVPRKNPCFYKC-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.61 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|