C19H26Cl3N3O4 — CID 51729866
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] N-[(1S)-2,2,2-trichloro-1-(4-nitroanilino)ethyl]carbamate (PubChem CID 51729866) has the molecular formula C19H26Cl3N3O4 and a molecular weight of 466.79 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] N-[(1S)-2,2,2-trichloro-1-(4-nitroanilino)ethyl]carbamate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] N-[(1S)-2,2,2-trichloro-1-(4-nitroanilino)ethyl]carbamate |
|---|---|
| PubChem CID | 51729866 |
| Molecular Formula | C19H26Cl3N3O4 |
| Molecular Weight | 466.79 g/mol |
| Exact Mass | 465.10 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] N-[(1S)-2,2,2-trichloro-1-(4-nitroanilino)ethyl]carbamate |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1OC(=O)N[C@H](Nc1ccc([N+](=O)[O-])cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C19H26Cl3N3O4/c1-11(2)15-9-4-12(3)10-16(15)29-18(26)24-17(19(20,21)22)23-13-5-7-14(8-6-13)25(27)28/h5-8,11-12,15-17,23H,4,9-10H2,1-3H3,(H,24,26)/t12-,15+,16-,17+/m1/s1 |
| InChIKey | HXLDLGPOKADBKW-ZFVVBOAOSA-N |
| XLogP | 5.89 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.79 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|