C17H23Cl2NO2 — CID 43835253
(5-methyl-2-propan-2-ylcyclohexyl) N-(3,4-dichlorophenyl)carbamate (PubChem CID 43835253) has the molecular formula C17H23Cl2NO2 and a molecular weight of 344.28 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylcyclohexyl) N-(3,4-dichlorophenyl)carbamate.
| Compound Name | (5-methyl-2-propan-2-ylcyclohexyl) N-(3,4-dichlorophenyl)carbamate |
|---|---|
| PubChem CID | 43835253 |
| Molecular Formula | C17H23Cl2NO2 |
| Molecular Weight | 344.28 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl) N-(3,4-dichlorophenyl)carbamate |
| SMILES | CC1CCC(C(C)C)C(OC(=O)Nc2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C17H23Cl2NO2/c1-10(2)13-6-4-11(3)8-16(13)22-17(21)20-12-5-7-14(18)15(19)9-12/h5,7,9-11,13,16H,4,6,8H2,1-3H3,(H,20,21) |
| InChIKey | SVARYGKGRMWTLF-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.28 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |