C23H34Cl2O3 — CID 147937519
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2S)-2-(3,4-dichlorophenyl)-7-hydroxyheptanoate (PubChem CID 147937519) has the molecular formula C23H34Cl2O3 and a molecular weight of 429.43 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2S)-2-(3,4-dichlorophenyl)-7-hydroxyheptanoate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2S)-2-(3,4-dichlorophenyl)-7-hydroxyheptanoate |
|---|---|
| PubChem CID | 147937519 |
| Molecular Formula | C23H34Cl2O3 |
| Molecular Weight | 429.43 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2S)-2-(3,4-dichlorophenyl)-7-hydroxyheptanoate |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1OC(=O)[C@@H](CCCCCO)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C23H34Cl2O3/c1-15(2)18-10-8-16(3)13-22(18)28-23(27)19(7-5-4-6-12-26)17-9-11-20(24)21(25)14-17/h9,11,14-16,18-19,22,26H,4-8,10,12-13H2,1-3H3/t16-,18+,19+,22-/m1/s1 |
| InChIKey | ILBWVLDNILXPBO-PGVBMLAISA-N |
| XLogP | 6.63 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.43 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|