C18H26Cl3N3O2 — CID 51682285
[(1R,2S,5S)-5-methyl-2-propan-2-ylcyclohexyl] N-[(1S)-2,2,2-trichloro-1-(pyridin-2-ylamino)ethyl]carbamate (PubChem CID 51682285) has the molecular formula C18H26Cl3N3O2 and a molecular weight of 422.78 g/mol. Its IUPAC name is [(1R,2S,5S)-5-methyl-2-propan-2-ylcyclohexyl] N-[(1S)-2,2,2-trichloro-1-(pyridin-2-ylamino)ethyl]carbamate.
| Compound Name | [(1R,2S,5S)-5-methyl-2-propan-2-ylcyclohexyl] N-[(1S)-2,2,2-trichloro-1-(pyridin-2-ylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 51682285 |
| Molecular Formula | C18H26Cl3N3O2 |
| Molecular Weight | 422.78 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | [(1R,2S,5S)-5-methyl-2-propan-2-ylcyclohexyl] N-[(1S)-2,2,2-trichloro-1-(pyridin-2-ylamino)ethyl]carbamate |
| SMILES | CC(C)[C@@H]1CC[C@H](C)C[C@H]1OC(=O)N[C@H](Nc1ccccn1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C18H26Cl3N3O2/c1-11(2)13-8-7-12(3)10-14(13)26-17(25)24-16(18(19,20)21)23-15-6-4-5-9-22-15/h4-6,9,11-14,16H,7-8,10H2,1-3H3,(H,22,23)(H,24,25)/t12-,13-,14+,16-/m0/s1 |
| InChIKey | PQOGPQCDZDICOM-AYDFFVQHSA-N |
| XLogP | 5.38 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.78 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|