C17H24N2O5 — CID 51703907
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-(5-nitro-2-oxo-1-pyridinyl)acetate (PubChem CID 51703907) has the molecular formula C17H24N2O5 and a molecular weight of 336.39 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-(5-nitro-2-oxo-1-pyridinyl)acetate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-(5-nitro-2-oxo-1-pyridinyl)acetate |
|---|---|
| PubChem CID | 51703907 |
| Molecular Formula | C17H24N2O5 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-(5-nitro-2-oxo-1-pyridinyl)acetate |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1OC(=O)Cn1cc([N+](=O)[O-])ccc1=O |
| InChI | InChI=1S/C17H24N2O5/c1-11(2)14-6-4-12(3)8-15(14)24-17(21)10-18-9-13(19(22)23)5-7-16(18)20/h5,7,9,11-12,14-15H,4,6,8,10H2,1-3H3/t12-,14+,15-/m1/s1 |
| InChIKey | VELPPHVHIQFEQU-VHDGCEQUSA-N |
| XLogP | 2.76 |
| TPSA | 91.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|