C25H29N3O4 — CID 129230703
[(1R,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-[2-(4-nitrophenyl)benzimidazol-1-yl]acetate (PubChem CID 129230703) has the molecular formula C25H29N3O4 and a molecular weight of 435.52 g/mol. Its IUPAC name is [(1R,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-[2-(4-nitrophenyl)benzimidazol-1-yl]acetate.
| Compound Name | [(1R,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-[2-(4-nitrophenyl)benzimidazol-1-yl]acetate |
|---|---|
| PubChem CID | 129230703 |
| Molecular Formula | C25H29N3O4 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | [(1R,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-[2-(4-nitrophenyl)benzimidazol-1-yl]acetate |
| SMILES | CC(C)C1CC[C@@H](C)C[C@H]1OC(=O)Cn1c(-c2ccc([N+](=O)[O-])cc2)nc2ccccc21 |
| InChI | InChI=1S/C25H29N3O4/c1-16(2)20-13-8-17(3)14-23(20)32-24(29)15-27-22-7-5-4-6-21(22)26-25(27)18-9-11-19(12-10-18)28(30)31/h4-7,9-12,16-17,20,23H,8,13-15H2,1-3H3/t17-,20?,23-/m1/s1 |
| InChIKey | QPDLMERIVNYAOG-LRRFZDQKSA-N |
| XLogP | 5.62 |
| TPSA | 87.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|