C21H30N2O2 — CID 129230372
[(5S)-5-methyl-2-propan-2-ylcyclohexyl] 2-(2-ethylbenzimidazol-1-yl)acetate (PubChem CID 129230372) has the molecular formula C21H30N2O2 and a molecular weight of 342.48 g/mol. Its IUPAC name is [(5S)-5-methyl-2-propan-2-ylcyclohexyl] 2-(2-ethylbenzimidazol-1-yl)acetate.
| Compound Name | [(5S)-5-methyl-2-propan-2-ylcyclohexyl] 2-(2-ethylbenzimidazol-1-yl)acetate |
|---|---|
| PubChem CID | 129230372 |
| Molecular Formula | C21H30N2O2 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | [(5S)-5-methyl-2-propan-2-ylcyclohexyl] 2-(2-ethylbenzimidazol-1-yl)acetate |
| SMILES | CCc1nc2ccccc2n1CC(=O)OC1C[C@@H](C)CCC1C(C)C |
| InChI | InChI=1S/C21H30N2O2/c1-5-20-22-17-8-6-7-9-18(17)23(20)13-21(24)25-19-12-15(4)10-11-16(19)14(2)3/h6-9,14-16,19H,5,10-13H2,1-4H3/t15-,16?,19?/m0/s1 |
| InChIKey | CEQBEARYCNVICJ-LYGPFTKASA-N |
| XLogP | 4.60 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |