C26H32BrIN2O2 — CID 159207063
[(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-[2-(4-bromophenyl)-3-methylbenzimidazol-3-ium-1-yl]acetate iodide (PubChem CID 159207063) has the molecular formula C26H32BrIN2O2 and a molecular weight of 611.36 g/mol. Its IUPAC name is [(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-[2-(4-bromophenyl)-3-methylbenzimidazol-3-ium-1-yl]acetate iodide.
| Compound Name | [(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-[2-(4-bromophenyl)-3-methylbenzimidazol-3-ium-1-yl]acetate iodide |
|---|---|
| PubChem CID | 159207063 |
| Molecular Formula | C26H32BrIN2O2 |
| Molecular Weight | 611.36 g/mol |
| Exact Mass | 610.07 |
| IUPAC Name | [(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-[2-(4-bromophenyl)-3-methylbenzimidazol-3-ium-1-yl]acetate iodide |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)CC1OC(=O)Cn1c(-c2ccc(Br)cc2)[n+](C)c2ccccc21.[I-] |
| InChI | InChI=1S/C26H32BrN2O2.HI/c1-17(2)21-14-9-18(3)15-24(21)31-25(30)16-29-23-8-6-5-7-22(23)28(4)26(29)19-10-12-20(27)13-11-19;/h5-8,10-13,17-18,21,24H,9,14-16H2,1-4H3;1H/q+1;/p-1/t18-,21+,24?;/m1./s1 |
| InChIKey | QZZWOVDGLYISKZ-LNTCVFOCSA-M |
| XLogP | 2.90 |
| TPSA | 35.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.36 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|