C32H42N3O3+ — CID 129230983
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2R)-2-[2-[4-(dicyclopropylamino)phenyl]-3-methylbenzimidazol-3-ium-1-yl]-2-hydroxyacetate (PubChem CID 129230983) has the molecular formula C32H42N3O3+ and a molecular weight of 516.71 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2R)-2-[2-[4-(dicyclopropylamino)phenyl]-3-methylbenzimidazol-3-ium-1-yl]-2-hydroxyacetate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2R)-2-[2-[4-(dicyclopropylamino)phenyl]-3-methylbenzimidazol-3-ium-1-yl]-2-hydroxyacetate |
|---|---|
| PubChem CID | 129230983 |
| Molecular Formula | C32H42N3O3+ |
| Molecular Weight | 516.71 g/mol |
| Exact Mass | 516.32 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2R)-2-[2-[4-(dicyclopropylamino)phenyl]-3-methylbenzimidazol-3-ium-1-yl]-2-hydroxyacetate |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1OC(=O)[C@@H](O)n1c(-c2ccc(N(C3CC3)C3CC3)cc2)[n+](C)c2ccccc21 |
| InChI | InChI=1S/C32H42N3O3/c1-20(2)26-18-9-21(3)19-29(26)38-32(37)31(36)35-28-8-6-5-7-27(28)33(4)30(35)22-10-12-23(13-11-22)34(24-14-15-24)25-16-17-25/h5-8,10-13,20-21,24-26,29,31,36H,9,14-19H2,1-4H3/q+1/t21-,26+,29-,31-/m1/s1 |
| InChIKey | RWLNBLDPRHUEFQ-FUTPHSBZSA-N |
| XLogP | 5.76 |
| TPSA | 58.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.71 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|