C28H37N2O3+ — CID 3092516
(5-methyl-2-propan-2-ylcyclohexyl) 2-[3-methyl-2-[(2-methylphenoxy)methyl]benzimidazol-3-ium-1-yl]acetate (PubChem CID 3092516) has the molecular formula C28H37N2O3+ and a molecular weight of 449.62 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylcyclohexyl) 2-[3-methyl-2-[(2-methylphenoxy)methyl]benzimidazol-3-ium-1-yl]acetate.
| Compound Name | (5-methyl-2-propan-2-ylcyclohexyl) 2-[3-methyl-2-[(2-methylphenoxy)methyl]benzimidazol-3-ium-1-yl]acetate |
|---|---|
| PubChem CID | 3092516 |
| Molecular Formula | C28H37N2O3+ |
| Molecular Weight | 449.62 g/mol |
| Exact Mass | 449.28 |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl) 2-[3-methyl-2-[(2-methylphenoxy)methyl]benzimidazol-3-ium-1-yl]acetate |
| SMILES | Cc1ccccc1OCc1n(CC(=O)OC2CC(C)CCC2C(C)C)c2ccccc2[n+]1C |
| InChI | InChI=1S/C28H37N2O3/c1-19(2)22-15-14-20(3)16-26(22)33-28(31)17-30-24-12-8-7-11-23(24)29(5)27(30)18-32-25-13-9-6-10-21(25)4/h6-13,19-20,22,26H,14-18H2,1-5H3/q+1 |
| InChIKey | OHZBSGJYECCCNY-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 44.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.62 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|