C23H32IN3O2 — CID 160664829
[(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-(2-ethyl-6-isocyano-3-methylbenzimidazol-3-ium-1-yl)acetate iodide (PubChem CID 160664829) has the molecular formula C23H32IN3O2 and a molecular weight of 509.43 g/mol. Its IUPAC name is [(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-(2-ethyl-6-isocyano-3-methylbenzimidazol-3-ium-1-yl)acetate iodide.
| Compound Name | [(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-(2-ethyl-6-isocyano-3-methylbenzimidazol-3-ium-1-yl)acetate iodide |
|---|---|
| PubChem CID | 160664829 |
| Molecular Formula | C23H32IN3O2 |
| Molecular Weight | 509.43 g/mol |
| Exact Mass | 509.15 |
| IUPAC Name | [(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-(2-ethyl-6-isocyano-3-methylbenzimidazol-3-ium-1-yl)acetate iodide |
| SMILES | [C-]#[N+]c1ccc2c(c1)n(CC(=O)OC1C[C@H](C)CC[C@H]1C(C)C)c(CC)[n+]2C.[I-] |
| InChI | InChI=1S/C23H32N3O2.HI/c1-7-22-25(6)19-11-9-17(24-5)13-20(19)26(22)14-23(27)28-21-12-16(4)8-10-18(21)15(2)3;/h9,11,13,15-16,18,21H,7-8,10,12,14H2,1-4,6H3;1H/q+1;/p-1/t16-,18+,21?;/m1./s1 |
| InChIKey | NBUOBADTNHAFKG-CSGVCMAJSA-M |
| XLogP | 1.59 |
| TPSA | 39.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.43 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|