C22H32IN3O4 — CID 157430454
[(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-(2-ethyl-3-methyl-6-nitrobenzimidazol-3-ium-1-yl)acetate iodide (PubChem CID 157430454) has the molecular formula C22H32IN3O4 and a molecular weight of 529.42 g/mol. Its IUPAC name is [(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-(2-ethyl-3-methyl-6-nitrobenzimidazol-3-ium-1-yl)acetate iodide.
| Compound Name | [(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-(2-ethyl-3-methyl-6-nitrobenzimidazol-3-ium-1-yl)acetate iodide |
|---|---|
| PubChem CID | 157430454 |
| Molecular Formula | C22H32IN3O4 |
| Molecular Weight | 529.42 g/mol |
| Exact Mass | 529.14 |
| IUPAC Name | [(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-(2-ethyl-3-methyl-6-nitrobenzimidazol-3-ium-1-yl)acetate iodide |
| SMILES | CCc1n(CC(=O)OC2C[C@H](C)CC[C@H]2C(C)C)c2cc([N+](=O)[O-])ccc2[n+]1C.[I-] |
| InChI | InChI=1S/C22H32N3O4.HI/c1-6-21-23(5)18-10-8-16(25(27)28)12-19(18)24(21)13-22(26)29-20-11-15(4)7-9-17(20)14(2)3;/h8,10,12,14-15,17,20H,6-7,9,11,13H2,1-5H3;1H/q+1;/p-1/t15-,17+,20?;/m1./s1 |
| InChIKey | CWZQLQSFEGWITB-JPDAQUKBSA-M |
| XLogP | 0.94 |
| TPSA | 78.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.42 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|