C17H31NO2 — CID 3092154
(5-methyl-2-propan-2-ylcyclohexyl) 2-piperidin-1-ylacetate (PubChem CID 3092154) has the molecular formula C17H31NO2 and a molecular weight of 281.44 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylcyclohexyl) 2-piperidin-1-ylacetate.
| Compound Name | (5-methyl-2-propan-2-ylcyclohexyl) 2-piperidin-1-ylacetate |
|---|---|
| PubChem CID | 3092154 |
| Molecular Formula | C17H31NO2 |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.24 |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl) 2-piperidin-1-ylacetate |
| SMILES | CC1CCC(C(C)C)C(OC(=O)CN2CCCCC2)C1 |
| InChI | InChI=1S/C17H31NO2/c1-13(2)15-8-7-14(3)11-16(15)20-17(19)12-18-9-5-4-6-10-18/h13-16H,4-12H2,1-3H3 |
| InChIKey | OGERQOKJJMDILG-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |