C16H14Cl3N3O3 — CID 1106942
2-nitro-N-[(1S)-2,2,2-trichloro-1-(4-methylanilino)ethyl]benzamide (PubChem CID 1106942) has the molecular formula C16H14Cl3N3O3 and a molecular weight of 402.67 g/mol. Its IUPAC name is 2-nitro-N-[(1S)-2,2,2-trichloro-1-(4-methylanilino)ethyl]benzamide.
| Compound Name | 2-nitro-N-[(1S)-2,2,2-trichloro-1-(4-methylanilino)ethyl]benzamide |
|---|---|
| PubChem CID | 1106942 |
| Molecular Formula | C16H14Cl3N3O3 |
| Molecular Weight | 402.67 g/mol |
| Exact Mass | 401.01 |
| IUPAC Name | 2-nitro-N-[(1S)-2,2,2-trichloro-1-(4-methylanilino)ethyl]benzamide |
| SMILES | Cc1ccc(N[C@@H](NC(=O)c2ccccc2[N+](=O)[O-])C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C16H14Cl3N3O3/c1-10-6-8-11(9-7-10)20-15(16(17,18)19)21-14(23)12-4-2-3-5-13(12)22(24)25/h2-9,15,20H,1H3,(H,21,23)/t15-/m0/s1 |
| InChIKey | ZWBIPVNMBIHLFY-HNNXBMFYSA-N |
| XLogP | 4.44 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.67 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|