C15H13Cl3N4O5S — CID 2316941
2-nitro-N-[(1R)-2,2,2-trichloro-1-(4-sulfamoylanilino)ethyl]benzamide (PubChem CID 2316941) has the molecular formula C15H13Cl3N4O5S and a molecular weight of 467.72 g/mol. Its IUPAC name is 2-nitro-N-[(1R)-2,2,2-trichloro-1-(4-sulfamoylanilino)ethyl]benzamide.
| Compound Name | 2-nitro-N-[(1R)-2,2,2-trichloro-1-(4-sulfamoylanilino)ethyl]benzamide |
|---|---|
| PubChem CID | 2316941 |
| Molecular Formula | C15H13Cl3N4O5S |
| Molecular Weight | 467.72 g/mol |
| Exact Mass | 465.97 |
| IUPAC Name | 2-nitro-N-[(1R)-2,2,2-trichloro-1-(4-sulfamoylanilino)ethyl]benzamide |
| SMILES | NS(=O)(=O)c1ccc(N[C@H](NC(=O)c2ccccc2[N+](=O)[O-])C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C15H13Cl3N4O5S/c16-15(17,18)14(20-9-5-7-10(8-6-9)28(19,26)27)21-13(23)11-3-1-2-4-12(11)22(24)25/h1-8,14,20H,(H,21,23)(H2,19,26,27)/t14-/m1/s1 |
| InChIKey | ABFXLZAOMQDREF-CQSZACIVSA-N |
| XLogP | 2.78 |
| TPSA | 144.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.72 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|