C15H14Br3N3O3S — CID 1380220
N-[(1R)-2,2,2-tribromo-1-(4-sulfamoylanilino)ethyl]benzamide (PubChem CID 1380220) has the molecular formula C15H14Br3N3O3S and a molecular weight of 556.07 g/mol. Its IUPAC name is N-[(1R)-2,2,2-tribromo-1-(4-sulfamoylanilino)ethyl]benzamide.
| Compound Name | N-[(1R)-2,2,2-tribromo-1-(4-sulfamoylanilino)ethyl]benzamide |
|---|---|
| PubChem CID | 1380220 |
| Molecular Formula | C15H14Br3N3O3S |
| Molecular Weight | 556.07 g/mol |
| Exact Mass | 552.83 |
| IUPAC Name | N-[(1R)-2,2,2-tribromo-1-(4-sulfamoylanilino)ethyl]benzamide |
| SMILES | NS(=O)(=O)c1ccc(N[C@H](NC(=O)c2ccccc2)C(Br)(Br)Br)cc1 |
| InChI | InChI=1S/C15H14Br3N3O3S/c16-15(17,18)14(21-13(22)10-4-2-1-3-5-10)20-11-6-8-12(9-7-11)25(19,23)24/h1-9,14,20H,(H,21,22)(H2,19,23,24)/t14-/m1/s1 |
| InChIKey | LDRCXSFJUTVNKY-CQSZACIVSA-N |
| XLogP | 3.34 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.07 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|