C12H16Cl3N3O3S — CID 3092663
2-methyl-N-[2,2,2-trichloro-1-(4-sulfamoylanilino)ethyl]propanamide (PubChem CID 3092663) has the molecular formula C12H16Cl3N3O3S and a molecular weight of 388.70 g/mol. Its IUPAC name is 2-methyl-N-[2,2,2-trichloro-1-(4-sulfamoylanilino)ethyl]propanamide.
| Compound Name | 2-methyl-N-[2,2,2-trichloro-1-(4-sulfamoylanilino)ethyl]propanamide |
|---|---|
| PubChem CID | 3092663 |
| Molecular Formula | C12H16Cl3N3O3S |
| Molecular Weight | 388.70 g/mol |
| Exact Mass | 387.00 |
| IUPAC Name | 2-methyl-N-[2,2,2-trichloro-1-(4-sulfamoylanilino)ethyl]propanamide |
| SMILES | CC(C)C(=O)NC(Nc1ccc(S(N)(=O)=O)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H16Cl3N3O3S/c1-7(2)10(19)18-11(12(13,14)15)17-8-3-5-9(6-4-8)22(16,20)21/h3-7,11,17H,1-2H3,(H,18,19)(H2,16,20,21) |
| InChIKey | NKWQKUFXMMJQHI-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.70 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|