C14H13Cl3N4O3S — CID 1089455
N-[(1S)-2,2,2-trichloro-1-(4-sulfamoylanilino)ethyl]pyridine-3-carboxamide (PubChem CID 1089455) has the molecular formula C14H13Cl3N4O3S and a molecular weight of 423.71 g/mol. Its IUPAC name is N-[(1S)-2,2,2-trichloro-1-(4-sulfamoylanilino)ethyl]pyridine-3-carboxamide.
| Compound Name | N-[(1S)-2,2,2-trichloro-1-(4-sulfamoylanilino)ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 1089455 |
| Molecular Formula | C14H13Cl3N4O3S |
| Molecular Weight | 423.71 g/mol |
| Exact Mass | 421.98 |
| IUPAC Name | N-[(1S)-2,2,2-trichloro-1-(4-sulfamoylanilino)ethyl]pyridine-3-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(N[C@@H](NC(=O)c2cccnc2)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C14H13Cl3N4O3S/c15-14(16,17)13(21-12(22)9-2-1-7-19-8-9)20-10-3-5-11(6-4-10)25(18,23)24/h1-8,13,20H,(H,21,22)(H2,18,23,24)/t13-/m0/s1 |
| InChIKey | MTFNWGJDFRUAPN-ZDUSSCGKSA-N |
| XLogP | 2.27 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.71 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|