C14H11Cl3N2OS — CID 1130366
N-[(1S)-2,2,2-trichloro-1-phenylsulfanylethyl]pyridine-3-carboxamide (PubChem CID 1130366) has the molecular formula C14H11Cl3N2OS and a molecular weight of 361.68 g/mol. Its IUPAC name is N-[(1S)-2,2,2-trichloro-1-phenylsulfanylethyl]pyridine-3-carboxamide.
| Compound Name | N-[(1S)-2,2,2-trichloro-1-phenylsulfanylethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 1130366 |
| Molecular Formula | C14H11Cl3N2OS |
| Molecular Weight | 361.68 g/mol |
| Exact Mass | 359.97 |
| IUPAC Name | N-[(1S)-2,2,2-trichloro-1-phenylsulfanylethyl]pyridine-3-carboxamide |
| SMILES | O=C(N[C@@H](Sc1ccccc1)C(Cl)(Cl)Cl)c1cccnc1 |
| InChI | InChI=1S/C14H11Cl3N2OS/c15-14(16,17)13(21-11-6-2-1-3-7-11)19-12(20)10-5-4-8-18-9-10/h1-9,13H,(H,19,20)/t13-/m0/s1 |
| InChIKey | VBQKVFLXXIVAFA-ZDUSSCGKSA-N |
| XLogP | 4.30 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.68 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|