C13H16Cl3N3O — CID 5001889
N-(2,2,2-trichloro-1-piperidin-1-ylethyl)pyridine-3-carboxamide (PubChem CID 5001889) has the molecular formula C13H16Cl3N3O and a molecular weight of 336.65 g/mol. Its IUPAC name is N-(2,2,2-trichloro-1-piperidin-1-ylethyl)pyridine-3-carboxamide.
| Compound Name | N-(2,2,2-trichloro-1-piperidin-1-ylethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 5001889 |
| Molecular Formula | C13H16Cl3N3O |
| Molecular Weight | 336.65 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | N-(2,2,2-trichloro-1-piperidin-1-ylethyl)pyridine-3-carboxamide |
| SMILES | O=C(NC(N1CCCCC1)C(Cl)(Cl)Cl)c1cccnc1 |
| InChI | InChI=1S/C13H16Cl3N3O/c14-13(15,16)12(19-7-2-1-3-8-19)18-11(20)10-5-4-6-17-9-10/h4-6,9,12H,1-3,7-8H2,(H,18,20) |
| InChIKey | HSCHLVWNPUJCCT-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.65 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|