C13H14Cl4N2O — CID 1048977
4-chloro-N-[(1S)-2,2,2-trichloro-1-pyrrolidin-1-ylethyl]benzamide (PubChem CID 1048977) has the molecular formula C13H14Cl4N2O and a molecular weight of 356.08 g/mol. Its IUPAC name is 4-chloro-N-[(1S)-2,2,2-trichloro-1-pyrrolidin-1-ylethyl]benzamide.
| Compound Name | 4-chloro-N-[(1S)-2,2,2-trichloro-1-pyrrolidin-1-ylethyl]benzamide |
|---|---|
| PubChem CID | 1048977 |
| Molecular Formula | C13H14Cl4N2O |
| Molecular Weight | 356.08 g/mol |
| Exact Mass | 353.99 |
| IUPAC Name | 4-chloro-N-[(1S)-2,2,2-trichloro-1-pyrrolidin-1-ylethyl]benzamide |
| SMILES | O=C(N[C@@H](N1CCCC1)C(Cl)(Cl)Cl)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H14Cl4N2O/c14-10-5-3-9(4-6-10)11(20)18-12(13(15,16)17)19-7-1-2-8-19/h3-6,12H,1-2,7-8H2,(H,18,20)/t12-/m0/s1 |
| InChIKey | FERFBERNSINOEZ-LBPRGKRZSA-N |
| XLogP | 3.86 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.08 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|