C16H21Cl3N2O — CID 3103488
N-[1-(azepan-1-yl)-2,2,2-trichloroethyl]-2-methylbenzamide (PubChem CID 3103488) has the molecular formula C16H21Cl3N2O and a molecular weight of 363.72 g/mol. Its IUPAC name is N-[1-(azepan-1-yl)-2,2,2-trichloroethyl]-2-methylbenzamide.
| Compound Name | N-[1-(azepan-1-yl)-2,2,2-trichloroethyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 3103488 |
| Molecular Formula | C16H21Cl3N2O |
| Molecular Weight | 363.72 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | N-[1-(azepan-1-yl)-2,2,2-trichloroethyl]-2-methylbenzamide |
| SMILES | Cc1ccccc1C(=O)NC(N1CCCCCC1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C16H21Cl3N2O/c1-12-8-4-5-9-13(12)14(22)20-15(16(17,18)19)21-10-6-2-3-7-11-21/h4-5,8-9,15H,2-3,6-7,10-11H2,1H3,(H,20,22) |
| InChIKey | MTADWOLXKRNYFP-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.72 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|