C14H16Cl3N3O3 — CID 1204588
2-nitro-N-[(1S)-2,2,2-trichloro-1-piperidin-1-ylethyl]benzamide (PubChem CID 1204588) has the molecular formula C14H16Cl3N3O3 and a molecular weight of 380.66 g/mol. Its IUPAC name is 2-nitro-N-[(1S)-2,2,2-trichloro-1-piperidin-1-ylethyl]benzamide.
| Compound Name | 2-nitro-N-[(1S)-2,2,2-trichloro-1-piperidin-1-ylethyl]benzamide |
|---|---|
| PubChem CID | 1204588 |
| Molecular Formula | C14H16Cl3N3O3 |
| Molecular Weight | 380.66 g/mol |
| Exact Mass | 379.03 |
| IUPAC Name | 2-nitro-N-[(1S)-2,2,2-trichloro-1-piperidin-1-ylethyl]benzamide |
| SMILES | O=C(N[C@@H](N1CCCCC1)C(Cl)(Cl)Cl)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H16Cl3N3O3/c15-14(16,17)13(19-8-4-1-5-9-19)18-12(21)10-6-2-3-7-11(10)20(22)23/h2-3,6-7,13H,1,4-5,8-9H2,(H,18,21)/t13-/m0/s1 |
| InChIKey | CUJDDYGWCFJOSR-ZDUSSCGKSA-N |
| XLogP | 3.51 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.66 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|