C13H14Cl4N2O2 — CID 3092687
3-chloro-N-(2,2,2-trichloro-1-morpholin-4-ylethyl)benzamide (PubChem CID 3092687) has the molecular formula C13H14Cl4N2O2 and a molecular weight of 372.08 g/mol. Its IUPAC name is 3-chloro-N-(2,2,2-trichloro-1-morpholin-4-ylethyl)benzamide.
| Compound Name | 3-chloro-N-(2,2,2-trichloro-1-morpholin-4-ylethyl)benzamide |
|---|---|
| PubChem CID | 3092687 |
| Molecular Formula | C13H14Cl4N2O2 |
| Molecular Weight | 372.08 g/mol |
| Exact Mass | 369.98 |
| IUPAC Name | 3-chloro-N-(2,2,2-trichloro-1-morpholin-4-ylethyl)benzamide |
| SMILES | O=C(NC(N1CCOCC1)C(Cl)(Cl)Cl)c1cccc(Cl)c1 |
| InChI | InChI=1S/C13H14Cl4N2O2/c14-10-3-1-2-9(8-10)11(20)18-12(13(15,16)17)19-4-6-21-7-5-19/h1-3,8,12H,4-7H2,(H,18,20) |
| InChIKey | JVOFXWZTXFPBNX-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.08 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|