C11H12Cl4NO4P — CID 34255344
4-chloro-N-[(1R)-2,2,2-trichloro-1-dimethoxyphosphorylethyl]benzamide (PubChem CID 34255344) has the molecular formula C11H12Cl4NO4P and a molecular weight of 395.01 g/mol. Its IUPAC name is 4-chloro-N-[(1R)-2,2,2-trichloro-1-dimethoxyphosphorylethyl]benzamide.
| Compound Name | 4-chloro-N-[(1R)-2,2,2-trichloro-1-dimethoxyphosphorylethyl]benzamide |
|---|---|
| PubChem CID | 34255344 |
| Molecular Formula | C11H12Cl4NO4P |
| Molecular Weight | 395.01 g/mol |
| Exact Mass | 392.93 |
| IUPAC Name | 4-chloro-N-[(1R)-2,2,2-trichloro-1-dimethoxyphosphorylethyl]benzamide |
| SMILES | COP(=O)(OC)[C@@H](NC(=O)c1ccc(Cl)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H12Cl4NO4P/c1-19-21(18,20-2)10(11(13,14)15)16-9(17)7-3-5-8(12)6-4-7/h3-6,10H,1-2H3,(H,16,17)/t10-/m1/s1 |
| InChIKey | FRZOXQYMIDRPRJ-SNVBAGLBSA-N |
| XLogP | 4.25 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.01 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|