C14H16ClNO5 — CID 52694056
dimethyl (2S)-2-[(4-chlorobenzoyl)amino]pentanedioate (PubChem CID 52694056) has the molecular formula C14H16ClNO5 and a molecular weight of 313.74 g/mol. Its IUPAC name is dimethyl (2S)-2-[(4-chlorobenzoyl)amino]pentanedioate.
| Compound Name | dimethyl (2S)-2-[(4-chlorobenzoyl)amino]pentanedioate |
|---|---|
| PubChem CID | 52694056 |
| Molecular Formula | C14H16ClNO5 |
| Molecular Weight | 313.74 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | dimethyl (2S)-2-[(4-chlorobenzoyl)amino]pentanedioate |
| SMILES | COC(=O)CC[C@H](NC(=O)c1ccc(Cl)cc1)C(=O)OC |
| InChI | InChI=1S/C14H16ClNO5/c1-20-12(17)8-7-11(14(19)21-2)16-13(18)9-3-5-10(15)6-4-9/h3-6,11H,7-8H2,1-2H3,(H,16,18)/t11-/m0/s1 |
| InChIKey | QKEJUZOTDYLIBA-NSHDSACASA-N |
| XLogP | 1.56 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.74 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |