C15H18ClNO4 — CID 54433742
methyl 4-[(4-chlorobenzoyl)amino]-5-oxoheptanoate (PubChem CID 54433742) has the molecular formula C15H18ClNO4 and a molecular weight of 311.76 g/mol. Its IUPAC name is methyl 4-[(4-chlorobenzoyl)amino]-5-oxoheptanoate.
| Compound Name | methyl 4-[(4-chlorobenzoyl)amino]-5-oxoheptanoate |
|---|---|
| PubChem CID | 54433742 |
| Molecular Formula | C15H18ClNO4 |
| Molecular Weight | 311.76 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | methyl 4-[(4-chlorobenzoyl)amino]-5-oxoheptanoate |
| SMILES | CCC(=O)C(CCC(=O)OC)NC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H18ClNO4/c1-3-13(18)12(8-9-14(19)21-2)17-15(20)10-4-6-11(16)7-5-10/h4-7,12H,3,8-9H2,1-2H3,(H,17,20) |
| InChIKey | WJHHTDXOPYADCN-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.76 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |