C13H13ClINO5 — CID 103219400
2-[(3-chloro-4-iodobenzoyl)amino]-5-methoxy-5-oxopentanoic acid (PubChem CID 103219400) has the molecular formula C13H13ClINO5 and a molecular weight of 425.61 g/mol. Its IUPAC name is 2-[(3-chloro-4-iodobenzoyl)amino]-5-methoxy-5-oxopentanoic acid.
| Compound Name | 2-[(3-chloro-4-iodobenzoyl)amino]-5-methoxy-5-oxopentanoic acid |
|---|---|
| PubChem CID | 103219400 |
| Molecular Formula | C13H13ClINO5 |
| Molecular Weight | 425.61 g/mol |
| Exact Mass | 424.95 |
| IUPAC Name | 2-[(3-chloro-4-iodobenzoyl)amino]-5-methoxy-5-oxopentanoic acid |
| SMILES | COC(=O)CCC(NC(=O)c1ccc(I)c(Cl)c1)C(=O)O |
| InChI | InChI=1S/C13H13ClINO5/c1-21-11(17)5-4-10(13(19)20)16-12(18)7-2-3-9(15)8(14)6-7/h2-3,6,10H,4-5H2,1H3,(H,16,18)(H,19,20) |
| InChIKey | PKXPOFQWYASRBT-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.61 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|