C12H12ClIN2O4 — CID 163908839
(4R)-5-amino-4-[(3-chloro-4-iodobenzoyl)amino]-5-oxopentanoic acid (PubChem CID 163908839) has the molecular formula C12H12ClIN2O4 and a molecular weight of 410.60 g/mol. Its IUPAC name is (4R)-5-amino-4-[(3-chloro-4-iodobenzoyl)amino]-5-oxopentanoic acid.
| Compound Name | (4R)-5-amino-4-[(3-chloro-4-iodobenzoyl)amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 163908839 |
| Molecular Formula | C12H12ClIN2O4 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 409.95 |
| IUPAC Name | (4R)-5-amino-4-[(3-chloro-4-iodobenzoyl)amino]-5-oxopentanoic acid |
| SMILES | NC(=O)[C@@H](CCC(=O)O)NC(=O)c1ccc(I)c(Cl)c1 |
| InChI | InChI=1S/C12H12ClIN2O4/c13-7-5-6(1-2-8(7)14)12(20)16-9(11(15)19)3-4-10(17)18/h1-2,5,9H,3-4H2,(H2,15,19)(H,16,20)(H,17,18)/t9-/m1/s1 |
| InChIKey | QQHWYVFKZOYFBY-SECBINFHSA-N |
| XLogP | 1.39 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|