C20H22N2O4 — CID 67332881
(4S)-5-amino-4-[[4-(2,5-dimethylphenyl)benzoyl]amino]-5-oxopentanoic acid (PubChem CID 67332881) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is (4S)-5-amino-4-[[4-(2,5-dimethylphenyl)benzoyl]amino]-5-oxopentanoic acid.
| Compound Name | (4S)-5-amino-4-[[4-(2,5-dimethylphenyl)benzoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 67332881 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | (4S)-5-amino-4-[[4-(2,5-dimethylphenyl)benzoyl]amino]-5-oxopentanoic acid |
| SMILES | Cc1ccc(C)c(-c2ccc(C(=O)N[C@@H](CCC(=O)O)C(N)=O)cc2)c1 |
| InChI | InChI=1S/C20H22N2O4/c1-12-3-4-13(2)16(11-12)14-5-7-15(8-6-14)20(26)22-17(19(21)25)9-10-18(23)24/h3-8,11,17H,9-10H2,1-2H3,(H2,21,25)(H,22,26)(H,23,24)/t17-/m0/s1 |
| InChIKey | HVEPVSAPTTVAPP-KRWDZBQOSA-N |
| XLogP | 2.42 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |