About (4S)-5-amino-4-[[4-(3,4-difluorophenyl)benzoyl]amino]-5-oxopentanoic acid
(4S)-5-amino-4-[[4-(3,4-difluorophenyl)benzoyl]amino]-5-oxopentanoic acid (PubChem CID 142694079) has the molecular formula C18H16F2N2O4
and a molecular weight of 362.33 g/mol. Its IUPAC name is (4S)-5-amino-4-[[4-(3,4-difluorophenyl)benzoyl]amino]-5-oxopentanoic acid.
Molecular Properties
| Compound Name | (4S)-5-amino-4-[[4-(3,4-difluorophenyl)benzoyl]amino]-5-oxopentanoic acid |
| PubChem CID | 142694079 |
| Molecular Formula | C18H16F2N2O4 |
| Molecular Weight | 362.33 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | (4S)-5-amino-4-[[4-(3,4-difluorophenyl)benzoyl]amino]-5-oxopentanoic acid |
| SMILES | NC(=O)[C@H](CCC(=O)O)NC(=O)c1ccc(-c2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C18H16F2N2O4/c19-13-6-5-12(9-14(13)20)10-1-3-11(4-2-10)18(26)22-15(17(21)25)7-8-16(23)24/h1-6,9,15H,7-8H2,(H2,21,25)(H,22,26)(H,23,24)/t15-/m0/s1 |
| InChIKey | XAHHLACOCOKHQY-HNNXBMFYSA-N |
| XLogP | 2.08 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.33 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4S)-5-amino-4-[[4-(3,4-difluorophenyl)benzoyl]amino]-5-oxopentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-5-amino-4-[[4-(3,4-difluorophenyl)benzoyl]amino]-5-oxopentanoic acid?
The IUPAC name of (4S)-5-amino-4-[[4-(3,4-difluorophenyl)benzoyl]amino]-5-oxopentanoic acid (CID 142694079) is (4S)-5-amino-4-[[4-(3,4-difluorophenyl)benzoyl]amino]-5-oxopentanoic acid.
What is the SMILES notation for (4S)-5-amino-4-[[4-(3,4-difluorophenyl)benzoyl]amino]-5-oxopentanoic acid?
The canonical SMILES for (4S)-5-amino-4-[[4-(3,4-difluorophenyl)benzoyl]amino]-5-oxopentanoic acid is NC(=O)[C@H](CCC(=O)O)NC(=O)c1ccc(-c2ccc(F)c(F)c2)cc1.
What is the InChIKey of (4S)-5-amino-4-[[4-(3,4-difluorophenyl)benzoyl]amino]-5-oxopentanoic acid?
The InChIKey is XAHHLACOCOKHQY-HNNXBMFYSA-N. The full InChI is InChI=1S/C18H16F2N2O4/c19-13-6-5-12(9-14(13)20)10-1-3-11(4-2-10)18(26)22-15(17(21)25)7-8-16(23)24/h1-6,9,15H,7-8H2,(H2,21,25)(H,22,26)(H,23,24)/t15-/m0/s1.
What are the key properties of (4S)-5-amino-4-[[4-(3,4-difluorophenyl)benzoyl]amino]-5-oxopentanoic acid?
(4S)-5-amino-4-[[4-(3,4-difluorophenyl)benzoyl]amino]-5-oxopentanoic acid has a molecular weight of 362.33 g/mol, XLogP of 2.08, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-5-amino-4-[[4-(3,4-difluorophenyl)benzoyl]amino]-5-oxopentanoic acid is sourced from PubChem (CID 142694079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).