C12H14F2N2O3 — CID 67332594
(4S)-5-amino-4-[(3,4-difluorophenyl)methylamino]-5-oxopentanoic acid (PubChem CID 67332594) has the molecular formula C12H14F2N2O3 and a molecular weight of 272.25 g/mol. Its IUPAC name is (4S)-5-amino-4-[(3,4-difluorophenyl)methylamino]-5-oxopentanoic acid.
| Compound Name | (4S)-5-amino-4-[(3,4-difluorophenyl)methylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 67332594 |
| Molecular Formula | C12H14F2N2O3 |
| Molecular Weight | 272.25 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | (4S)-5-amino-4-[(3,4-difluorophenyl)methylamino]-5-oxopentanoic acid |
| SMILES | NC(=O)[C@H](CCC(=O)O)NCc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C12H14F2N2O3/c13-8-2-1-7(5-9(8)14)6-16-10(12(15)19)3-4-11(17)18/h1-2,5,10,16H,3-4,6H2,(H2,15,19)(H,17,18)/t10-/m0/s1 |
| InChIKey | WPPVXQWQOAVFRK-JTQLQIEISA-N |
| XLogP | 0.77 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.25 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |