C14H20N2O3 — CID 67333166
(4S)-5-amino-4-[(3,4-dimethylphenyl)methylamino]-5-oxopentanoic acid (PubChem CID 67333166) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is (4S)-5-amino-4-[(3,4-dimethylphenyl)methylamino]-5-oxopentanoic acid.
| Compound Name | (4S)-5-amino-4-[(3,4-dimethylphenyl)methylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 67333166 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | (4S)-5-amino-4-[(3,4-dimethylphenyl)methylamino]-5-oxopentanoic acid |
| SMILES | Cc1ccc(CN[C@@H](CCC(=O)O)C(N)=O)cc1C |
| InChI | InChI=1S/C14H20N2O3/c1-9-3-4-11(7-10(9)2)8-16-12(14(15)19)5-6-13(17)18/h3-4,7,12,16H,5-6,8H2,1-2H3,(H2,15,19)(H,17,18)/t12-/m0/s1 |
| InChIKey | QPLRTKMSWDICRP-LBPRGKRZSA-N |
| XLogP | 1.11 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |