C18H29NO5S — CID 171616794
methylsulfonyl (2S)-2-[(3,4-dimethylphenyl)methylamino]-5,5-dimethylhexaneperoxoate (PubChem CID 171616794) has the molecular formula C18H29NO5S and a molecular weight of 371.50 g/mol. Its IUPAC name is methylsulfonyl (2S)-2-[(3,4-dimethylphenyl)methylamino]-5,5-dimethylhexaneperoxoate.
| Compound Name | methylsulfonyl (2S)-2-[(3,4-dimethylphenyl)methylamino]-5,5-dimethylhexaneperoxoate |
|---|---|
| PubChem CID | 171616794 |
| Molecular Formula | C18H29NO5S |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | methylsulfonyl (2S)-2-[(3,4-dimethylphenyl)methylamino]-5,5-dimethylhexaneperoxoate |
| SMILES | Cc1ccc(CN[C@@H](CCC(C)(C)C)C(=O)OOS(C)(=O)=O)cc1C |
| InChI | InChI=1S/C18H29NO5S/c1-13-7-8-15(11-14(13)2)12-19-16(9-10-18(3,4)5)17(20)23-24-25(6,21)22/h7-8,11,16,19H,9-10,12H2,1-6H3/t16-/m0/s1 |
| InChIKey | AJXPKCUTHUUDRO-INIZCTEOSA-N |
| XLogP | 3.02 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|