C20H32N2O5S — CID 175558847
2-[(1,7-dimethylindol-4-yl)methylamino]-5,5-dimethylhexanoic acid;methanesulfonic acid (PubChem CID 175558847) has the molecular formula C20H32N2O5S and a molecular weight of 412.55 g/mol. Its IUPAC name is 2-[(1,7-dimethylindol-4-yl)methylamino]-5,5-dimethylhexanoic acid;methanesulfonic acid.
| Compound Name | 2-[(1,7-dimethylindol-4-yl)methylamino]-5,5-dimethylhexanoic acid;methanesulfonic acid |
|---|---|
| PubChem CID | 175558847 |
| Molecular Formula | C20H32N2O5S |
| Molecular Weight | 412.55 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | 2-[(1,7-dimethylindol-4-yl)methylamino]-5,5-dimethylhexanoic acid;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.Cc1ccc(CNC(CCC(C)(C)C)C(=O)O)c2ccn(C)c12 |
| InChI | InChI=1S/C19H28N2O2.CH4O3S/c1-13-6-7-14(15-9-11-21(5)17(13)15)12-20-16(18(22)23)8-10-19(2,3)4;1-5(2,3)4/h6-7,9,11,16,20H,8,10,12H2,1-5H3,(H,22,23);1H3,(H,2,3,4) |
| InChIKey | NYCNOGKHQQRNMS-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 108.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.55 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|