C18H24N2O2 — CID 167496493
(2S)-2-(isoquinolin-5-ylmethylamino)-5,5-dimethylhexanoic acid (PubChem CID 167496493) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is (2S)-2-(isoquinolin-5-ylmethylamino)-5,5-dimethylhexanoic acid.
| Compound Name | (2S)-2-(isoquinolin-5-ylmethylamino)-5,5-dimethylhexanoic acid |
|---|---|
| PubChem CID | 167496493 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | (2S)-2-(isoquinolin-5-ylmethylamino)-5,5-dimethylhexanoic acid |
| SMILES | CC(C)(C)CC[C@H](NCc1cccc2cnccc12)C(=O)O |
| InChI | InChI=1S/C18H24N2O2/c1-18(2,3)9-7-16(17(21)22)20-12-14-6-4-5-13-11-19-10-8-15(13)14/h4-6,8,10-11,16,20H,7,9,12H2,1-3H3,(H,21,22)/t16-/m0/s1 |
| InChIKey | FHAIRLDLKPEIAF-INIZCTEOSA-N |
| XLogP | 3.60 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |